C6H8N4OS — CID 91451221
3-azido-1-(1,2-thiazol-3-yl)propan-1-ol (PubChem CID 91451221) has the molecular formula C6H8N4OS and a molecular weight of 184.22 g/mol. Its IUPAC name is 3-azido-1-(1,2-thiazol-3-yl)propan-1-ol.
| Compound Name | 3-azido-1-(1,2-thiazol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 91451221 |
| Molecular Formula | C6H8N4OS |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 3-azido-1-(1,2-thiazol-3-yl)propan-1-ol |
| SMILES | [N-]=[N+]=NCCC(O)c1ccsn1 |
| InChI | InChI=1S/C6H8N4OS/c7-10-8-3-1-6(11)5-2-4-12-9-5/h2,4,6,11H,1,3H2 |
| InChIKey | FICORXNBAMUGLT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 81.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|