C5H5F2NOS — CID 131096578
2,2-difluoro-1-(1,2-thiazol-3-yl)ethanol (PubChem CID 131096578) has the molecular formula C5H5F2NOS and a molecular weight of 165.16 g/mol. Its IUPAC name is 2,2-difluoro-1-(1,2-thiazol-3-yl)ethanol.
| Compound Name | 2,2-difluoro-1-(1,2-thiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 131096578 |
| Molecular Formula | C5H5F2NOS |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.01 |
| IUPAC Name | 2,2-difluoro-1-(1,2-thiazol-3-yl)ethanol |
| SMILES | OC(c1ccsn1)C(F)F |
| InChI | InChI=1S/C5H5F2NOS/c6-5(7)4(9)3-1-2-10-8-3/h1-2,4-5,9H |
| InChIKey | OFDFZCGGWNKKJI-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |