C6H9NO2S — CID 130604797
1-(1,2-thiazol-3-yl)propane-1,2-diol (PubChem CID 130604797) has the molecular formula C6H9NO2S and a molecular weight of 159.21 g/mol. Its IUPAC name is 1-(1,2-thiazol-3-yl)propane-1,2-diol.
| Compound Name | 1-(1,2-thiazol-3-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 130604797 |
| Molecular Formula | C6H9NO2S |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 1-(1,2-thiazol-3-yl)propane-1,2-diol |
| SMILES | CC(O)C(O)c1ccsn1 |
| InChI | InChI=1S/C6H9NO2S/c1-4(8)6(9)5-2-3-10-7-5/h2-4,6,8-9H,1H3 |
| InChIKey | SCFZBUCCSILXER-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |