C8H6BrNO2S — CID 131101510
(5-bromofuran-2-yl)-(1,2-thiazol-3-yl)methanol (PubChem CID 131101510) has the molecular formula C8H6BrNO2S and a molecular weight of 260.11 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-(1,2-thiazol-3-yl)methanol.
| Compound Name | (5-bromofuran-2-yl)-(1,2-thiazol-3-yl)methanol |
|---|---|
| PubChem CID | 131101510 |
| Molecular Formula | C8H6BrNO2S |
| Molecular Weight | 260.11 g/mol |
| Exact Mass | 258.93 |
| IUPAC Name | (5-bromofuran-2-yl)-(1,2-thiazol-3-yl)methanol |
| SMILES | OC(c1ccsn1)c1ccc(Br)o1 |
| InChI | InChI=1S/C8H6BrNO2S/c9-7-2-1-6(12-7)8(11)5-3-4-13-10-5/h1-4,8,11H |
| InChIKey | MUEABXDCZHHABR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.11 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |