C5H6ClNS — CID 130920926
3-(1-chloroethyl)-1,2-thiazole (PubChem CID 130920926) has the molecular formula C5H6ClNS and a molecular weight of 147.63 g/mol. Its IUPAC name is 3-(1-chloroethyl)-1,2-thiazole.
| Compound Name | 3-(1-chloroethyl)-1,2-thiazole |
|---|---|
| PubChem CID | 130920926 |
| Molecular Formula | C5H6ClNS |
| Molecular Weight | 147.63 g/mol |
| Exact Mass | 146.99 |
| IUPAC Name | 3-(1-chloroethyl)-1,2-thiazole |
| SMILES | CC(Cl)c1ccsn1 |
| InChI | InChI=1S/C5H6ClNS/c1-4(6)5-2-3-8-7-5/h2-4H,1H3 |
| InChIKey | LICIKNWSOMFNCC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.63 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|