C7H10N2S — CID 130632089
1-(1,2-thiazol-3-yl)but-3-en-1-amine (PubChem CID 130632089) has the molecular formula C7H10N2S and a molecular weight of 154.24 g/mol. Its IUPAC name is 1-(1,2-thiazol-3-yl)but-3-en-1-amine.
| Compound Name | 1-(1,2-thiazol-3-yl)but-3-en-1-amine |
|---|---|
| PubChem CID | 130632089 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 1-(1,2-thiazol-3-yl)but-3-en-1-amine |
| SMILES | C=CCC(N)c1ccsn1 |
| InChI | InChI=1S/C7H10N2S/c1-2-3-6(8)7-4-5-10-9-7/h2,4-6H,1,3,8H2 |
| InChIKey | NSNDMIXEODMAPU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|