C9H14ClNS — CID 171203150
(1R)-1-(3-methylthiophen-2-yl)but-3-en-1-amine;hydrochloride (PubChem CID 171203150) has the molecular formula C9H14ClNS and a molecular weight of 203.74 g/mol. Its IUPAC name is (1R)-1-(3-methylthiophen-2-yl)but-3-en-1-amine;hydrochloride.
| Compound Name | (1R)-1-(3-methylthiophen-2-yl)but-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171203150 |
| Molecular Formula | C9H14ClNS |
| Molecular Weight | 203.74 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | (1R)-1-(3-methylthiophen-2-yl)but-3-en-1-amine;hydrochloride |
| SMILES | C=CC[C@@H](N)c1sccc1C.Cl |
| InChI | InChI=1S/C9H13NS.ClH/c1-3-4-8(10)9-7(2)5-6-11-9;/h3,5-6,8H,1,4,10H2,2H3;1H/t8-;/m1./s1 |
| InChIKey | GEUBYCKDIRAYPA-DDWIOCJRSA-N |
| XLogP | 3.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.74 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|