C10H18N2S — CID 171222710
(1S)-1-(3-methylthiophen-2-yl)pentane-1,5-diamine (PubChem CID 171222710) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is (1S)-1-(3-methylthiophen-2-yl)pentane-1,5-diamine.
| Compound Name | (1S)-1-(3-methylthiophen-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 171222710 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | (1S)-1-(3-methylthiophen-2-yl)pentane-1,5-diamine |
| SMILES | Cc1ccsc1[C@@H](N)CCCCN |
| InChI | InChI=1S/C10H18N2S/c1-8-5-7-13-10(8)9(12)4-2-3-6-11/h5,7,9H,2-4,6,11-12H2,1H3/t9-/m0/s1 |
| InChIKey | BJAYXHGQSRABJF-VIFPVBQESA-N |
| XLogP | 2.19 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|