C13H23N3S — CID 116942064
1-(3-methylthiophen-2-yl)-4-piperazin-1-ylbutan-1-amine (PubChem CID 116942064) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-(3-methylthiophen-2-yl)-4-piperazin-1-ylbutan-1-amine.
| Compound Name | 1-(3-methylthiophen-2-yl)-4-piperazin-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 116942064 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 1-(3-methylthiophen-2-yl)-4-piperazin-1-ylbutan-1-amine |
| SMILES | Cc1ccsc1C(N)CCCN1CCNCC1 |
| InChI | InChI=1S/C13H23N3S/c1-11-4-10-17-13(11)12(14)3-2-7-16-8-5-15-6-9-16/h4,10,12,15H,2-3,5-9,14H2,1H3 |
| InChIKey | XDFXGMQASREICN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |