About (2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol
(2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol (PubChem CID 130927982) has the molecular formula C8H8N2O2S
and a molecular weight of 196.23 g/mol. Its IUPAC name is (2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol.
Analyze (2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol?
The IUPAC name of (2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol (CID 130927982) is (2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol.
What is the SMILES notation for (2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol?
The canonical SMILES for (2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol is Cc1nc(C(O)c2ccsn2)co1.
What is the InChIKey of (2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol?
The InChIKey is SXQLWJLRZXODQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O2S/c1-5-9-7(4-12-5)8(11)6-2-3-13-10-6/h2-4,8,11H,1H3.
What are the key properties of (2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol?
(2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol has a molecular weight of 196.23 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-1,3-oxazol-4-yl)-(1,2-thiazol-3-yl)methanol is sourced from PubChem (CID 130927982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).