C9H11NO2 — CID 130517640
1-(2-methyl-1,3-oxazol-4-yl)pent-4-yn-1-ol (PubChem CID 130517640) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 1-(2-methyl-1,3-oxazol-4-yl)pent-4-yn-1-ol.
| Compound Name | 1-(2-methyl-1,3-oxazol-4-yl)pent-4-yn-1-ol |
|---|---|
| PubChem CID | 130517640 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 1-(2-methyl-1,3-oxazol-4-yl)pent-4-yn-1-ol |
| SMILES | C#CCCC(O)c1coc(C)n1 |
| InChI | InChI=1S/C9H11NO2/c1-3-4-5-9(11)8-6-12-7(2)10-8/h1,6,9,11H,4-5H2,2H3 |
| InChIKey | RHBQZHSRUUYOFB-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|