C7H10F2N2S — CID 130719275
3-(4,4-difluorobutan-2-yl)-1H-imidazole-2-thione (PubChem CID 130719275) has the molecular formula C7H10F2N2S and a molecular weight of 192.23 g/mol. Its IUPAC name is 3-(4,4-difluorobutan-2-yl)-1H-imidazole-2-thione.
| Compound Name | 3-(4,4-difluorobutan-2-yl)-1H-imidazole-2-thione |
|---|---|
| PubChem CID | 130719275 |
| Molecular Formula | C7H10F2N2S |
| Molecular Weight | 192.23 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 3-(4,4-difluorobutan-2-yl)-1H-imidazole-2-thione |
| SMILES | CC(CC(F)F)n1cc[nH]c1=S |
| InChI | InChI=1S/C7H10F2N2S/c1-5(4-6(8)9)11-3-2-10-7(11)12/h2-3,5-6H,4H2,1H3,(H,10,12) |
| InChIKey | QPAVZHCTUBUKLN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.23 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|