C8H15ClN2O — CID 130722720
1-(3-chloropropyl)-3-methyl-1,3-diazinan-2-one (PubChem CID 130722720) has the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. Its IUPAC name is 1-(3-chloropropyl)-3-methyl-1,3-diazinan-2-one.
| Compound Name | 1-(3-chloropropyl)-3-methyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 130722720 |
| Molecular Formula | C8H15ClN2O |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 1-(3-chloropropyl)-3-methyl-1,3-diazinan-2-one |
| SMILES | CN1CCCN(CCCCl)C1=O |
| InChI | InChI=1S/C8H15ClN2O/c1-10-5-3-7-11(8(10)12)6-2-4-9/h2-7H2,1H3 |
| InChIKey | MOECRMCJBARZCG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|