2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride

C7H13ClN2O3S — CID 23566514

IUPAC2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride
SMILESCN1CCCN(CCS(=O)(=O)Cl)C1=O
InChIInChI=1S/C7H13ClN2O3S/c1-9-3-2-4-10(7(9)11)5-6-14(8,12)13/h2-6H2,1H3
InChIKeyMJMDPVVZTBLNME-UHFFFAOYSA-N
MW240.71 g/mol
LogP0.31
Rot. Bonds3

About 2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride

2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride (PubChem CID 23566514) has the molecular formula C7H13ClN2O3S and a molecular weight of 240.71 g/mol. Its IUPAC name is 2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride.

Molecular Properties

Compound Name2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride
PubChem CID23566514
Molecular FormulaC7H13ClN2O3S
Molecular Weight240.71 g/mol
Exact Mass240.03
IUPAC Name2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride
SMILESCN1CCCN(CCS(=O)(=O)Cl)C1=O
InChIInChI=1S/C7H13ClN2O3S/c1-9-3-2-4-10(7(9)11)5-6-14(8,12)13/h2-6H2,1H3
InChIKeyMJMDPVVZTBLNME-UHFFFAOYSA-N
XLogP0.31
TPSA57.69 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.71
LogP ≤ 50.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride?
The IUPAC name of 2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride (CID 23566514) is 2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride.
What is the SMILES notation for 2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride?
The canonical SMILES for 2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride is CN1CCCN(CCS(=O)(=O)Cl)C1=O.
What is the InChIKey of 2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride?
The InChIKey is MJMDPVVZTBLNME-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13ClN2O3S/c1-9-3-2-4-10(7(9)11)5-6-14(8,12)13/h2-6H2,1H3.
What are the key properties of 2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride?
2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride has a molecular weight of 240.71 g/mol, XLogP of 0.31, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-2-oxo-1,3-diazinan-1-yl)ethanesulfonyl chloride is sourced from PubChem (CID 23566514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).