C8H8ClF2N — CID 130725637
2-chloro-N-ethyl-4,5-difluoroaniline (PubChem CID 130725637) has the molecular formula C8H8ClF2N and a molecular weight of 191.61 g/mol. Its IUPAC name is 2-chloro-N-ethyl-4,5-difluoroaniline.
| Compound Name | 2-chloro-N-ethyl-4,5-difluoroaniline |
|---|---|
| PubChem CID | 130725637 |
| Molecular Formula | C8H8ClF2N |
| Molecular Weight | 191.61 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | 2-chloro-N-ethyl-4,5-difluoroaniline |
| SMILES | CCNc1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C8H8ClF2N/c1-2-12-8-4-7(11)6(10)3-5(8)9/h3-4,12H,2H2,1H3 |
| InChIKey | LGLPKFQIJPQPTL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|