C9H13ClN2OS — CID 130727351
4-chloro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]oxolan-3-amine (PubChem CID 130727351) has the molecular formula C9H13ClN2OS and a molecular weight of 232.74 g/mol. Its IUPAC name is 4-chloro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]oxolan-3-amine.
| Compound Name | 4-chloro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 130727351 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 4-chloro-N-[(4-methyl-1,3-thiazol-2-yl)methyl]oxolan-3-amine |
| SMILES | Cc1csc(CNC2COCC2Cl)n1 |
| InChI | InChI=1S/C9H13ClN2OS/c1-6-5-14-9(12-6)2-11-8-4-13-3-7(8)10/h5,7-8,11H,2-4H2,1H3 |
| InChIKey | SVGRRTAEMPWLNY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|