C13H23N3OS — CID 66259346
N-ethyl-4-[[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]methyl]oxolan-3-amine (PubChem CID 66259346) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is N-ethyl-4-[[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]methyl]oxolan-3-amine.
| Compound Name | N-ethyl-4-[[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 66259346 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-ethyl-4-[[2-(4-methyl-1,3-thiazol-2-yl)ethylamino]methyl]oxolan-3-amine |
| SMILES | CCNC1COCC1CNCCc1nc(C)cs1 |
| InChI | InChI=1S/C13H23N3OS/c1-3-15-12-8-17-7-11(12)6-14-5-4-13-16-10(2)9-18-13/h9,11-12,14-15H,3-8H2,1-2H3 |
| InChIKey | KHSSPOQVKTXAAA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|