About (2-chlorophenyl) prop-2-ynoate
(2-chlorophenyl) prop-2-ynoate (PubChem CID 130728916) has the molecular formula C9H5ClO2
and a molecular weight of 180.59 g/mol. Its IUPAC name is (2-chlorophenyl) prop-2-ynoate.
Molecular Properties
| Compound Name | (2-chlorophenyl) prop-2-ynoate |
| PubChem CID | 130728916 |
| Molecular Formula | C9H5ClO2 |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | (2-chlorophenyl) prop-2-ynoate |
| SMILES | C#CC(=O)Oc1ccccc1Cl |
| InChI | InChI=1S/C9H5ClO2/c1-2-9(11)12-8-6-4-3-5-7(8)10/h1,3-6H |
| InChIKey | GHJOTWBHMSBKKT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-chlorophenyl) prop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl) prop-2-ynoate?
The IUPAC name of (2-chlorophenyl) prop-2-ynoate (CID 130728916) is (2-chlorophenyl) prop-2-ynoate.
What is the SMILES notation for (2-chlorophenyl) prop-2-ynoate?
The canonical SMILES for (2-chlorophenyl) prop-2-ynoate is C#CC(=O)Oc1ccccc1Cl.
What is the InChIKey of (2-chlorophenyl) prop-2-ynoate?
The InChIKey is GHJOTWBHMSBKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClO2/c1-2-9(11)12-8-6-4-3-5-7(8)10/h1,3-6H.
What are the key properties of (2-chlorophenyl) prop-2-ynoate?
(2-chlorophenyl) prop-2-ynoate has a molecular weight of 180.59 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl) prop-2-ynoate is sourced from PubChem (CID 130728916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).