C8H11N3O — CID 130731441
5-[(but-2-ynylamino)methyl]-1,3-oxazol-2-amine (PubChem CID 130731441) has the molecular formula C8H11N3O and a molecular weight of 165.20 g/mol. Its IUPAC name is 5-[(but-2-ynylamino)methyl]-1,3-oxazol-2-amine.
| Compound Name | 5-[(but-2-ynylamino)methyl]-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 130731441 |
| Molecular Formula | C8H11N3O |
| Molecular Weight | 165.20 g/mol |
| Exact Mass | 165.09 |
| IUPAC Name | 5-[(but-2-ynylamino)methyl]-1,3-oxazol-2-amine |
| SMILES | CC#CCNCc1cnc(N)o1 |
| InChI | InChI=1S/C8H11N3O/c1-2-3-4-10-5-7-6-11-8(9)12-7/h6,10H,4-5H2,1H3,(H2,9,11) |
| InChIKey | ZQKUBUDHCLDLAQ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.20 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|