About 3-N-but-2-ynylpyrazine-2,3-diamine
3-N-but-2-ynylpyrazine-2,3-diamine (PubChem CID 102987241) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 3-N-but-2-ynylpyrazine-2,3-diamine.
Molecular Properties
| Compound Name | 3-N-but-2-ynylpyrazine-2,3-diamine |
| PubChem CID | 102987241 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 3-N-but-2-ynylpyrazine-2,3-diamine |
| SMILES | CC#CCNc1nccnc1N |
| InChI | InChI=1S/C8H10N4/c1-2-3-4-11-8-7(9)10-5-6-12-8/h5-6H,4H2,1H3,(H2,9,10)(H,11,12) |
| InChIKey | MJIYBBTYHPWEJP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-N-but-2-ynylpyrazine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-but-2-ynylpyrazine-2,3-diamine?
The IUPAC name of 3-N-but-2-ynylpyrazine-2,3-diamine (CID 102987241) is 3-N-but-2-ynylpyrazine-2,3-diamine.
What is the SMILES notation for 3-N-but-2-ynylpyrazine-2,3-diamine?
The canonical SMILES for 3-N-but-2-ynylpyrazine-2,3-diamine is CC#CCNc1nccnc1N.
What is the InChIKey of 3-N-but-2-ynylpyrazine-2,3-diamine?
The InChIKey is MJIYBBTYHPWEJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-2-3-4-11-8-7(9)10-5-6-12-8/h5-6H,4H2,1H3,(H2,9,10)(H,11,12).
What are the key properties of 3-N-but-2-ynylpyrazine-2,3-diamine?
3-N-but-2-ynylpyrazine-2,3-diamine has a molecular weight of 162.20 g/mol, XLogP of 0.49, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-but-2-ynylpyrazine-2,3-diamine is sourced from PubChem (CID 102987241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).