C8H10N4 — CID 102987241
3-N-but-2-ynylpyrazine-2,3-diamine (PubChem CID 102987241) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is 3-N-but-2-ynylpyrazine-2,3-diamine.
| Compound Name | 3-N-but-2-ynylpyrazine-2,3-diamine |
|---|---|
| PubChem CID | 102987241 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 3-N-but-2-ynylpyrazine-2,3-diamine |
| SMILES | CC#CCNc1nccnc1N |
| InChI | InChI=1S/C8H10N4/c1-2-3-4-11-8-7(9)10-5-6-12-8/h5-6H,4H2,1H3,(H2,9,10)(H,11,12) |
| InChIKey | MJIYBBTYHPWEJP-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|