C9H12BrNOS — CID 130735612
2-[(3-bromothiophen-2-yl)methyl]oxazinane (PubChem CID 130735612) has the molecular formula C9H12BrNOS and a molecular weight of 262.17 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)methyl]oxazinane.
| Compound Name | 2-[(3-bromothiophen-2-yl)methyl]oxazinane |
|---|---|
| PubChem CID | 130735612 |
| Molecular Formula | C9H12BrNOS |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 260.98 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)methyl]oxazinane |
| SMILES | Brc1ccsc1CN1CCCCO1 |
| InChI | InChI=1S/C9H12BrNOS/c10-8-3-6-13-9(8)7-11-4-1-2-5-12-11/h3,6H,1-2,4-5,7H2 |
| InChIKey | WOKXLKNZMIOFDE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |