C6H5N3O2 — CID 130738525
5-cyano-N-hydroxy-1H-pyrrole-3-carboxamide (PubChem CID 130738525) has the molecular formula C6H5N3O2 and a molecular weight of 151.12 g/mol. Its IUPAC name is 5-cyano-N-hydroxy-1H-pyrrole-3-carboxamide.
| Compound Name | 5-cyano-N-hydroxy-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 130738525 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 5-cyano-N-hydroxy-1H-pyrrole-3-carboxamide |
| SMILES | N#Cc1cc(C(=O)NO)c[nH]1 |
| InChI | InChI=1S/C6H5N3O2/c7-2-5-1-4(3-8-5)6(10)9-11/h1,3,8,11H,(H,9,10) |
| InChIKey | ZQUQUIXJMJWJNU-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|