C16H17N3O — CID 154841612
4-(4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carbonyl)-1H-pyrrole-2-carbonitrile (PubChem CID 154841612) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-(4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carbonyl)-1H-pyrrole-2-carbonitrile.
| Compound Name | 4-(4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carbonyl)-1H-pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 154841612 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-(4-azatricyclo[5.2.2.02,6]undec-8-ene-4-carbonyl)-1H-pyrrole-2-carbonitrile |
| SMILES | N#Cc1cc(C(=O)N2CC3C4C=CC(CC4)C3C2)c[nH]1 |
| InChI | InChI=1S/C16H17N3O/c17-6-13-5-12(7-18-13)16(20)19-8-14-10-1-2-11(4-3-10)15(14)9-19/h1-2,5,7,10-11,14-15,18H,3-4,8-9H2 |
| InChIKey | LPDZRNYRGRBFCJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|