C18H16F3N3O — CID 125142966
4-[(3S)-3-[3-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1H-pyrrole-2-carbonitrile (PubChem CID 125142966) has the molecular formula C18H16F3N3O and a molecular weight of 347.34 g/mol. Its IUPAC name is 4-[(3S)-3-[3-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1H-pyrrole-2-carbonitrile.
| Compound Name | 4-[(3S)-3-[3-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1H-pyrrole-2-carbonitrile |
|---|---|
| PubChem CID | 125142966 |
| Molecular Formula | C18H16F3N3O |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 4-[(3S)-3-[3-(trifluoromethyl)phenyl]piperidine-1-carbonyl]-1H-pyrrole-2-carbonitrile |
| SMILES | N#Cc1cc(C(=O)N2CCC[C@@H](c3cccc(C(F)(F)F)c3)C2)c[nH]1 |
| InChI | InChI=1S/C18H16F3N3O/c19-18(20,21)15-5-1-3-12(7-15)13-4-2-6-24(11-13)17(25)14-8-16(9-22)23-10-14/h1,3,5,7-8,10,13,23H,2,4,6,11H2/t13-/m1/s1 |
| InChIKey | ZDMOWWALTCZMCZ-CYBMUJFWSA-N |
| XLogP | 3.92 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |