C20H24F3NO3 — CID 136553556
4-[3-[3-(trifluoromethyl)phenyl]piperidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 136553556) has the molecular formula C20H24F3NO3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 4-[3-[3-(trifluoromethyl)phenyl]piperidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-[3-(trifluoromethyl)phenyl]piperidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 136553556 |
| Molecular Formula | C20H24F3NO3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 4-[3-[3-(trifluoromethyl)phenyl]piperidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N2CCCC(c3cccc(C(F)(F)F)c3)C2)CC1 |
| InChI | InChI=1S/C20H24F3NO3/c21-20(22,23)17-5-1-3-15(11-17)16-4-2-10-24(12-16)18(25)13-6-8-14(9-7-13)19(26)27/h1,3,5,11,13-14,16H,2,4,6-10,12H2,(H,26,27) |
| InChIKey | CPFVNNSXPAMWQO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |