C20H22N4O — CID 155960637
[(1R,2R,6S,7S)-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-[5-methyl-2-(1,2,4-triazol-4-yl)phenyl]methanone (PubChem CID 155960637) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is [(1R,2R,6S,7S)-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-[5-methyl-2-(1,2,4-triazol-4-yl)phenyl]methanone.
| Compound Name | [(1R,2R,6S,7S)-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-[5-methyl-2-(1,2,4-triazol-4-yl)phenyl]methanone |
|---|---|
| PubChem CID | 155960637 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(1R,2R,6S,7S)-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl]-[5-methyl-2-(1,2,4-triazol-4-yl)phenyl]methanone |
| SMILES | Cc1ccc(-n2cnnc2)c(C(=O)N2C[C@@H]3[C@H](C2)[C@H]2C=C[C@@H]3CC2)c1 |
| InChI | InChI=1S/C20H22N4O/c1-13-2-7-19(24-11-21-22-12-24)16(8-13)20(25)23-9-17-14-3-4-15(6-5-14)18(17)10-23/h2-4,7-8,11-12,14-15,17-18H,5-6,9-10H2,1H3/t14-,15+,17+,18- |
| InChIKey | XEQKTTLGDKRLTQ-YJEJQGFLSA-N |
| XLogP | 2.86 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|