C9H8BrN3 — CID 84700533
4-(2-bromo-4-methylphenyl)-1,2,4-triazole (PubChem CID 84700533) has the molecular formula C9H8BrN3 and a molecular weight of 238.09 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenyl)-1,2,4-triazole.
| Compound Name | 4-(2-bromo-4-methylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 84700533 |
| Molecular Formula | C9H8BrN3 |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 236.99 |
| IUPAC Name | 4-(2-bromo-4-methylphenyl)-1,2,4-triazole |
| SMILES | Cc1ccc(-n2cnnc2)c(Br)c1 |
| InChI | InChI=1S/C9H8BrN3/c1-7-2-3-9(8(10)4-7)13-5-11-12-6-13/h2-6H,1H3 |
| InChIKey | ABXDNZWCHWXAEM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |