C18H24ClN3O2 — CID 133121439
3-chloro-5-[(1S,5S)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]-1H-pyridin-2-one (PubChem CID 133121439) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 3-chloro-5-[(1S,5S)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]-1H-pyridin-2-one.
| Compound Name | 3-chloro-5-[(1S,5S)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 133121439 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 3-chloro-5-[(1S,5S)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonane-3-carbonyl]-1H-pyridin-2-one |
| SMILES | CC(C)=CCN1C[C@@H]2CC[C@H]1CN(C(=O)c1c[nH]c(=O)c(Cl)c1)C2 |
| InChI | InChI=1S/C18H24ClN3O2/c1-12(2)5-6-21-9-13-3-4-15(21)11-22(10-13)18(24)14-7-16(19)17(23)20-8-14/h5,7-8,13,15H,3-4,6,9-11H2,1-2H3,(H,20,23)/t13-,15-/m0/s1 |
| InChIKey | LFJKYZCGWXWFJE-ZFWWWQNUSA-N |
| XLogP | 2.53 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|