C19H30N4O — CID 133130816
[(1S,5S)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(5-propyl-1H-pyrazol-4-yl)methanone (PubChem CID 133130816) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is [(1S,5S)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(5-propyl-1H-pyrazol-4-yl)methanone.
| Compound Name | [(1S,5S)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(5-propyl-1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 133130816 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | [(1S,5S)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(5-propyl-1H-pyrazol-4-yl)methanone |
| SMILES | CCCc1[nH]ncc1C(=O)N1C[C@H]2CC[C@@H](C1)N(CC=C(C)C)C2 |
| InChI | InChI=1S/C19H30N4O/c1-4-5-18-17(10-20-21-18)19(24)23-12-15-6-7-16(13-23)22(11-15)9-8-14(2)3/h8,10,15-16H,4-7,9,11-13H2,1-3H3,(H,20,21)/t15-,16-/m0/s1 |
| InChIKey | SUDJDXLSXQTLGJ-HOTGVXAUSA-N |
| XLogP | 2.86 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|