C22H27N5O — CID 70707917
[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(2-pyridin-4-ylpyrimidin-5-yl)methanone (PubChem CID 70707917) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is [(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(2-pyridin-4-ylpyrimidin-5-yl)methanone.
| Compound Name | [(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(2-pyridin-4-ylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 70707917 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(2-pyridin-4-ylpyrimidin-5-yl)methanone |
| SMILES | CC(C)=CCN1C[C@H]2CC[C@@H]1CN(C(=O)c1cnc(-c3ccncc3)nc1)C2 |
| InChI | InChI=1S/C22H27N5O/c1-16(2)7-10-26-13-17-3-4-20(26)15-27(14-17)22(28)19-11-24-21(25-12-19)18-5-8-23-9-6-18/h5-9,11-12,17,20H,3-4,10,13-15H2,1-2H3/t17-,20-/m1/s1 |
| InChIKey | CXVASDIBEGADJW-YLJYHZDGSA-N |
| XLogP | 3.04 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|