C23H31N3O — CID 70734852
(2,3-dimethyl-1H-indol-5-yl)-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone (PubChem CID 70734852) has the molecular formula C23H31N3O and a molecular weight of 365.52 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-5-yl)-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-5-yl)-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone |
|---|---|
| PubChem CID | 70734852 |
| Molecular Formula | C23H31N3O |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.25 |
| IUPAC Name | (2,3-dimethyl-1H-indol-5-yl)-[(1R,5R)-6-(3-methylbut-2-enyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]methanone |
| SMILES | CC(C)=CCN1C[C@H]2CC[C@@H]1CN(C(=O)c1ccc3[nH]c(C)c(C)c3c1)C2 |
| InChI | InChI=1S/C23H31N3O/c1-15(2)9-10-25-12-18-5-7-20(25)14-26(13-18)23(27)19-6-8-22-21(11-19)16(3)17(4)24-22/h6,8-9,11,18,20,24H,5,7,10,12-14H2,1-4H3/t18-,20-/m1/s1 |
| InChIKey | ZSFLGOBRZRGADU-UYAOXDASSA-N |
| XLogP | 4.29 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|