C21H26FN3O — CID 70757953
[(1R,5R)-6-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(5-fluoro-3-methyl-1H-indol-2-yl)methanone (PubChem CID 70757953) has the molecular formula C21H26FN3O and a molecular weight of 355.46 g/mol. Its IUPAC name is [(1R,5R)-6-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(5-fluoro-3-methyl-1H-indol-2-yl)methanone.
| Compound Name | [(1R,5R)-6-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(5-fluoro-3-methyl-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 70757953 |
| Molecular Formula | C21H26FN3O |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | [(1R,5R)-6-(cyclopropylmethyl)-3,6-diazabicyclo[3.2.2]nonan-3-yl]-(5-fluoro-3-methyl-1H-indol-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2C[C@@H]3CC[C@H](C2)N(CC2CC2)C3)[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C21H26FN3O/c1-13-18-8-16(22)5-7-19(18)23-20(13)21(26)25-11-15-4-6-17(12-25)24(10-15)9-14-2-3-14/h5,7-8,14-15,17,23H,2-4,6,9-12H2,1H3/t15-,17-/m1/s1 |
| InChIKey | KAMGAISOEFUWHN-NVXWUHKLSA-N |
| XLogP | 3.56 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|