C7H6N2O2S — CID 130741870
methyl imidazo[5,1-b][1,3]thiazole-3-carboxylate (PubChem CID 130741870) has the molecular formula C7H6N2O2S and a molecular weight of 182.20 g/mol. Its IUPAC name is methyl imidazo[5,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | methyl imidazo[5,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 130741870 |
| Molecular Formula | C7H6N2O2S |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | methyl imidazo[5,1-b][1,3]thiazole-3-carboxylate |
| SMILES | COC(=O)c1csc2cncn12 |
| InChI | InChI=1S/C7H6N2O2S/c1-11-7(10)5-3-12-6-2-8-4-9(5)6/h2-4H,1H3 |
| InChIKey | GYSDONVYKNGFAN-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |