C16H12N2O3S — CID 130744618
2-(1,3-dioxoisoindol-2-yl)-3-methoxybenzenecarbothioamide (PubChem CID 130744618) has the molecular formula C16H12N2O3S and a molecular weight of 312.35 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-methoxybenzenecarbothioamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-3-methoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 130744618 |
| Molecular Formula | C16H12N2O3S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-3-methoxybenzenecarbothioamide |
| SMILES | COc1cccc(C(N)=S)c1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H12N2O3S/c1-21-12-8-4-7-11(14(17)22)13(12)18-15(19)9-5-2-3-6-10(9)16(18)20/h2-8H,1H3,(H2,17,22) |
| InChIKey | AEDCNTOKSMNMAG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|