C10H19ClN2O2 — CID 130748048
(2R)-N-[2-(hydroxymethyl)cyclopentyl]azetidine-2-carboxamide;hydrochloride (PubChem CID 130748048) has the molecular formula C10H19ClN2O2 and a molecular weight of 234.73 g/mol. Its IUPAC name is (2R)-N-[2-(hydroxymethyl)cyclopentyl]azetidine-2-carboxamide;hydrochloride.
| Compound Name | (2R)-N-[2-(hydroxymethyl)cyclopentyl]azetidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 130748048 |
| Molecular Formula | C10H19ClN2O2 |
| Molecular Weight | 234.73 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | (2R)-N-[2-(hydroxymethyl)cyclopentyl]azetidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCCC1CO)[C@H]1CCN1 |
| InChI | InChI=1S/C10H18N2O2.ClH/c13-6-7-2-1-3-8(7)12-10(14)9-4-5-11-9;/h7-9,11,13H,1-6H2,(H,12,14);1H/t7?,8?,9-;/m1./s1 |
| InChIKey | KZZAKOYYRJGHGG-BTVWAASQSA-N |
| XLogP | 0.05 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.73 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |