C13H25NO3 — CID 130752711
tert-butyl N-[(2S,3R)-1-hydroxy-3,5-dimethylhex-4-en-2-yl]carbamate (PubChem CID 130752711) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-1-hydroxy-3,5-dimethylhex-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-1-hydroxy-3,5-dimethylhex-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 130752711 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | tert-butyl N-[(2S,3R)-1-hydroxy-3,5-dimethylhex-4-en-2-yl]carbamate |
| SMILES | CC(C)=C[C@@H](C)[C@@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25NO3/c1-9(2)7-10(3)11(8-15)14-12(16)17-13(4,5)6/h7,10-11,15H,8H2,1-6H3,(H,14,16)/t10-,11-/m1/s1 |
| InChIKey | BRPJNJAGOQQUIJ-GHMZBOCLSA-N |
| XLogP | 2.47 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|