C23H35N3O — CID 13075355
5-ethyl-N-[2-(4-heptyl-2-methylphenoxy)ethyl]-6-methylpyrimidin-4-amine (PubChem CID 13075355) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is 5-ethyl-N-[2-(4-heptyl-2-methylphenoxy)ethyl]-6-methylpyrimidin-4-amine.
| Compound Name | 5-ethyl-N-[2-(4-heptyl-2-methylphenoxy)ethyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 13075355 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | 5-ethyl-N-[2-(4-heptyl-2-methylphenoxy)ethyl]-6-methylpyrimidin-4-amine |
| SMILES | CCCCCCCc1ccc(OCCNc2ncnc(C)c2CC)c(C)c1 |
| InChI | InChI=1S/C23H35N3O/c1-5-7-8-9-10-11-20-12-13-22(18(3)16-20)27-15-14-24-23-21(6-2)19(4)25-17-26-23/h12-13,16-17H,5-11,14-15H2,1-4H3,(H,24,25,26) |
| InChIKey | NNLQIKLQTIYOBM-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|