C20H28ClN3O — CID 13075403
5-chloro-N-[2-(2-hexyl-6-methylphenoxy)ethyl]-6-methylpyrimidin-4-amine (PubChem CID 13075403) has the molecular formula C20H28ClN3O and a molecular weight of 361.92 g/mol. Its IUPAC name is 5-chloro-N-[2-(2-hexyl-6-methylphenoxy)ethyl]-6-methylpyrimidin-4-amine.
| Compound Name | 5-chloro-N-[2-(2-hexyl-6-methylphenoxy)ethyl]-6-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 13075403 |
| Molecular Formula | C20H28ClN3O |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 5-chloro-N-[2-(2-hexyl-6-methylphenoxy)ethyl]-6-methylpyrimidin-4-amine |
| SMILES | CCCCCCc1cccc(C)c1OCCNc1ncnc(C)c1Cl |
| InChI | InChI=1S/C20H28ClN3O/c1-4-5-6-7-10-17-11-8-9-15(2)19(17)25-13-12-22-20-18(21)16(3)23-14-24-20/h8-9,11,14H,4-7,10,12-13H2,1-3H3,(H,22,23,24) |
| InChIKey | RVNDDPXCKLZKRW-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|