C11H18O — CID 130754394
(1R,4R)-3,4,7,7-tetramethylbicyclo[2.2.1]heptan-2-one (PubChem CID 130754394) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (1R,4R)-3,4,7,7-tetramethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,4R)-3,4,7,7-tetramethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 130754394 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (1R,4R)-3,4,7,7-tetramethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1C(=O)[C@@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C11H18O/c1-7-9(12)8-5-6-11(7,4)10(8,2)3/h7-8H,5-6H2,1-4H3/t7?,8-,11+/m0/s1 |
| InChIKey | PVJBDKPUGIYGTI-CUROVOOSSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |