About 1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one
1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one (PubChem CID 2750624) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is 1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one.
Analyze 1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one?
The IUPAC name of 1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one (CID 2750624) is 1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one.
What is the SMILES notation for 1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one?
The canonical SMILES for 1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one is CC1(C)C2CCC1(C)C1NC(=O)NC21.
What is the InChIKey of 1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one?
The InChIKey is LMMABUVLJKVRDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O/c1-10(2)6-4-5-11(10,3)8-7(6)12-9(14)13-8/h6-8H,4-5H2,1-3H3,(H2,12,13,14).
What are the key properties of 1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one?
1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one has a molecular weight of 194.28 g/mol, XLogP of 1.49, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10,10-trimethyl-3,5-diazatricyclo[5.2.1.02,6]decan-4-one is sourced from PubChem (CID 2750624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).