About 1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane
1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane (PubChem CID 88759012) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane.
Analyze 1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane?
The IUPAC name of 1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane (CID 88759012) is 1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane.
What is the SMILES notation for 1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane?
The canonical SMILES for 1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane is CC1(C)C2CCC1(C)C1OCCOC21.
What is the InChIKey of 1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane?
The InChIKey is MRQPZPLEQYPTJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O2/c1-11(2)8-4-5-12(11,3)10-9(8)13-6-7-14-10/h8-10H,4-7H2,1-3H3.
What are the key properties of 1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane?
1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane has a molecular weight of 196.29 g/mol, XLogP of 2.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,11,11-trimethyl-3,6-dioxatricyclo[6.2.1.02,7]undecane is sourced from PubChem (CID 88759012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).