C15H26O2 — CID 70487131
(2R,4S,6R,7R)-1,10,10-trimethyl-4-propan-2-yloxy-3-oxatricyclo[5.2.1.02,6]decane (PubChem CID 70487131) has the molecular formula C15H26O2 and a molecular weight of 238.37 g/mol. Its IUPAC name is (2R,4S,6R,7R)-1,10,10-trimethyl-4-propan-2-yloxy-3-oxatricyclo[5.2.1.02,6]decane.
| Compound Name | (2R,4S,6R,7R)-1,10,10-trimethyl-4-propan-2-yloxy-3-oxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 70487131 |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.19 |
| IUPAC Name | (2R,4S,6R,7R)-1,10,10-trimethyl-4-propan-2-yloxy-3-oxatricyclo[5.2.1.02,6]decane |
| SMILES | CC(C)O[C@@H]1C[C@@H]2[C@H]3CCC(C)([C@@H]2O1)C3(C)C |
| InChI | InChI=1S/C15H26O2/c1-9(2)16-12-8-10-11-6-7-15(5,13(10)17-12)14(11,3)4/h9-13H,6-8H2,1-5H3/t10-,11-,12+,13-,15?/m1/s1 |
| InChIKey | DZWFSEYSTHLZAC-CKMVWSRUSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |