C18H32O2 — CID 15091817
(1R,2R,4R,6R,7R)-4-[(2S)-hexan-2-yl]oxy-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decane (PubChem CID 15091817) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is (1R,2R,4R,6R,7R)-4-[(2S)-hexan-2-yl]oxy-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decane.
| Compound Name | (1R,2R,4R,6R,7R)-4-[(2S)-hexan-2-yl]oxy-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decane |
|---|---|
| PubChem CID | 15091817 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | (1R,2R,4R,6R,7R)-4-[(2S)-hexan-2-yl]oxy-1,10,10-trimethyl-3-oxatricyclo[5.2.1.02,6]decane |
| SMILES | CCCC[C@H](C)O[C@H]1C[C@@H]2[C@H]3CC[C@@](C)([C@@H]2O1)C3(C)C |
| InChI | InChI=1S/C18H32O2/c1-6-7-8-12(2)19-15-11-13-14-9-10-18(5,16(13)20-15)17(14,3)4/h12-16H,6-11H2,1-5H3/t12-,13+,14+,15+,16+,18-/m0/s1 |
| InChIKey | IGMICMUGIOUEMI-AIVZJVSBSA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |