C11H19NOSi — CID 130754526
(3S,4S)-3-propan-2-yl-4-(2-trimethylsilylethynyl)azetidin-2-one (PubChem CID 130754526) has the molecular formula C11H19NOSi and a molecular weight of 209.36 g/mol. Its IUPAC name is (3S,4S)-3-propan-2-yl-4-(2-trimethylsilylethynyl)azetidin-2-one.
| Compound Name | (3S,4S)-3-propan-2-yl-4-(2-trimethylsilylethynyl)azetidin-2-one |
|---|---|
| PubChem CID | 130754526 |
| Molecular Formula | C11H19NOSi |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (3S,4S)-3-propan-2-yl-4-(2-trimethylsilylethynyl)azetidin-2-one |
| SMILES | CC(C)[C@@H]1C(=O)N[C@@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C11H19NOSi/c1-8(2)10-9(12-11(10)13)6-7-14(3,4)5/h8-10H,1-5H3,(H,12,13)/t9-,10+/m1/s1 |
| InChIKey | DFPOVQXCIBGTLD-ZJUUUORDSA-N |
| XLogP | 1.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|