C11H19NO2Si — CID 172723544
(3R,4R)-3-(2-hydroxypropan-2-yl)-4-(2-trimethylsilylethynyl)azetidin-2-one (PubChem CID 172723544) has the molecular formula C11H19NO2Si and a molecular weight of 225.36 g/mol. Its IUPAC name is (3R,4R)-3-(2-hydroxypropan-2-yl)-4-(2-trimethylsilylethynyl)azetidin-2-one.
| Compound Name | (3R,4R)-3-(2-hydroxypropan-2-yl)-4-(2-trimethylsilylethynyl)azetidin-2-one |
|---|---|
| PubChem CID | 172723544 |
| Molecular Formula | C11H19NO2Si |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (3R,4R)-3-(2-hydroxypropan-2-yl)-4-(2-trimethylsilylethynyl)azetidin-2-one |
| SMILES | CC(C)(O)[C@@H]1C(=O)N[C@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C11H19NO2Si/c1-11(2,14)9-8(12-10(9)13)6-7-15(3,4)5/h8-9,14H,1-5H3,(H,12,13)/t8-,9-/m0/s1 |
| InChIKey | GVLYHIKQBVAZIU-IUCAKERBSA-N |
| XLogP | 0.75 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|