C8H6BrNS2 — CID 13075591
4-bromo-3-methyl-1,3-benzothiazole-2-thione (PubChem CID 13075591) has the molecular formula C8H6BrNS2 and a molecular weight of 260.18 g/mol. Its IUPAC name is 4-bromo-3-methyl-1,3-benzothiazole-2-thione.
| Compound Name | 4-bromo-3-methyl-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 13075591 |
| Molecular Formula | C8H6BrNS2 |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 258.91 |
| IUPAC Name | 4-bromo-3-methyl-1,3-benzothiazole-2-thione |
| SMILES | Cn1c(=S)sc2cccc(Br)c21 |
| InChI | InChI=1S/C8H6BrNS2/c1-10-7-5(9)3-2-4-6(7)12-8(10)11/h2-4H,1H3 |
| InChIKey | YMYYHSKDSHNZEH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|