C11H15BrN2S — CID 130757500
3-bromo-2-[(3-methylsulfanylpyrrolidin-1-yl)methyl]pyridine (PubChem CID 130757500) has the molecular formula C11H15BrN2S and a molecular weight of 287.23 g/mol. Its IUPAC name is 3-bromo-2-[(3-methylsulfanylpyrrolidin-1-yl)methyl]pyridine.
| Compound Name | 3-bromo-2-[(3-methylsulfanylpyrrolidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 130757500 |
| Molecular Formula | C11H15BrN2S |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 3-bromo-2-[(3-methylsulfanylpyrrolidin-1-yl)methyl]pyridine |
| SMILES | CSC1CCN(Cc2ncccc2Br)C1 |
| InChI | InChI=1S/C11H15BrN2S/c1-15-9-4-6-14(7-9)8-11-10(12)3-2-5-13-11/h2-3,5,9H,4,6-8H2,1H3 |
| InChIKey | UVCFQBRLCCKCHC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |