C11H14N2O2 — CID 13075793
N-[cyano(furan-2-yl)methyl]-2,2-dimethylpropanamide (PubChem CID 13075793) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is N-[cyano(furan-2-yl)methyl]-2,2-dimethylpropanamide.
| Compound Name | N-[cyano(furan-2-yl)methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 13075793 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N-[cyano(furan-2-yl)methyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC(C#N)c1ccco1 |
| InChI | InChI=1S/C11H14N2O2/c1-11(2,3)10(14)13-8(7-12)9-5-4-6-15-9/h4-6,8H,1-3H3,(H,13,14) |
| InChIKey | AVQJITNBYQBYOZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |