C13H14NO7- — CID 78468600
2-cyano-3-(furan-2-yl)-4,4,5-trimethoxy-5-oxopentanoate (PubChem CID 78468600) has the molecular formula C13H14NO7- and a molecular weight of 296.26 g/mol. Its IUPAC name is 2-cyano-3-(furan-2-yl)-4,4,5-trimethoxy-5-oxopentanoate.
| Compound Name | 2-cyano-3-(furan-2-yl)-4,4,5-trimethoxy-5-oxopentanoate |
|---|---|
| PubChem CID | 78468600 |
| Molecular Formula | C13H14NO7- |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 2-cyano-3-(furan-2-yl)-4,4,5-trimethoxy-5-oxopentanoate |
| SMILES | COC(=O)C(OC)(OC)C(c1ccco1)C(C#N)C(=O)[O-] |
| InChI | InChI=1S/C13H15NO7/c1-18-12(17)13(19-2,20-3)10(8(7-14)11(15)16)9-5-4-6-21-9/h4-6,8,10H,1-3H3,(H,15,16)/p-1 |
| InChIKey | KLFGJIHLXHYGDJ-UHFFFAOYSA-M |
| XLogP | -0.59 |
| TPSA | 121.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|