C16H18NO7- — CID 7285360
(2S,3S)-2-cyano-4,4,5-trimethoxy-3-(4-methoxyphenyl)-5-oxopentanoate (PubChem CID 7285360) has the molecular formula C16H18NO7- and a molecular weight of 336.32 g/mol. Its IUPAC name is (2S,3S)-2-cyano-4,4,5-trimethoxy-3-(4-methoxyphenyl)-5-oxopentanoate.
| Compound Name | (2S,3S)-2-cyano-4,4,5-trimethoxy-3-(4-methoxyphenyl)-5-oxopentanoate |
|---|---|
| PubChem CID | 7285360 |
| Molecular Formula | C16H18NO7- |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2S,3S)-2-cyano-4,4,5-trimethoxy-3-(4-methoxyphenyl)-5-oxopentanoate |
| SMILES | COC(=O)C(OC)(OC)[C@H](c1ccc(OC)cc1)[C@@H](C#N)C(=O)[O-] |
| InChI | InChI=1S/C16H19NO7/c1-21-11-7-5-10(6-8-11)13(12(9-17)14(18)19)16(23-3,24-4)15(20)22-2/h5-8,12-13H,1-4H3,(H,18,19)/p-1/t12-,13-/m1/s1 |
| InChIKey | HGKSIAYIAGUPIA-CHWSQXEVSA-M |
| XLogP | -0.17 |
| TPSA | 117.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|